C12H20N2O — CID 144554786
N,N-diethyl-1-phenylethanamine;nitroxyl (PubChem CID 144554786) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is N,N-diethyl-1-phenylethanamine;nitroxyl.
| Compound Name | N,N-diethyl-1-phenylethanamine;nitroxyl |
|---|---|
| PubChem CID | 144554786 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N,N-diethyl-1-phenylethanamine;nitroxyl |
| SMILES | CCN(CC)C(C)c1ccccc1.N=O |
| InChI | InChI=1S/C12H19N.HNO/c1-4-13(5-2)11(3)12-9-7-6-8-10-12;1-2/h6-11H,4-5H2,1-3H3;1H |
| InChIKey | INOMUZIQEJLDEC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |