C22H32N2 — CID 595707
N,N,N',N'-tetraethyl-1,2-diphenylethane-1,2-diamine (PubChem CID 595707) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is N,N,N',N'-tetraethyl-1,2-diphenylethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetraethyl-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 595707 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | N,N,N',N'-tetraethyl-1,2-diphenylethane-1,2-diamine |
| SMILES | CCN(CC)C(c1ccccc1)C(c1ccccc1)N(CC)CC |
| InChI | InChI=1S/C22H32N2/c1-5-23(6-2)21(19-15-11-9-12-16-19)22(24(7-3)8-4)20-17-13-10-14-18-20/h9-18,21-22H,5-8H2,1-4H3 |
| InChIKey | RXAHYONAAWOYAK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |