C26H40N2O4 — CID 613655
N,N,N',N'-tetrakis(2-methoxyethyl)-1,2-diphenylethane-1,2-diamine (PubChem CID 613655) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(2-methoxyethyl)-1,2-diphenylethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetrakis(2-methoxyethyl)-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 613655 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | N,N,N',N'-tetrakis(2-methoxyethyl)-1,2-diphenylethane-1,2-diamine |
| SMILES | COCCN(CCOC)C(c1ccccc1)C(c1ccccc1)N(CCOC)CCOC |
| InChI | InChI=1S/C26H40N2O4/c1-29-19-15-27(16-20-30-2)25(23-11-7-5-8-12-23)26(24-13-9-6-10-14-24)28(17-21-31-3)18-22-32-4/h5-14,25-26H,15-22H2,1-4H3 |
| InChIKey | BXPITWYQBSKCPR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |