C20H26O2 — CID 12709498
(1,6-dimethoxy-4-phenylhexan-3-yl)benzene (PubChem CID 12709498) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (1,6-dimethoxy-4-phenylhexan-3-yl)benzene.
| Compound Name | (1,6-dimethoxy-4-phenylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 12709498 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (1,6-dimethoxy-4-phenylhexan-3-yl)benzene |
| SMILES | COCCC(c1ccccc1)C(CCOC)c1ccccc1 |
| InChI | InChI=1S/C20H26O2/c1-21-15-13-19(17-9-5-3-6-10-17)20(14-16-22-2)18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3 |
| InChIKey | HOMMDVVLQCGEJU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |