C13H22N2 — CID 43180194
N,N-diethyl-N'-methyl-1-phenylethane-1,2-diamine (PubChem CID 43180194) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N,N-diethyl-N'-methyl-1-phenylethane-1,2-diamine.
| Compound Name | N,N-diethyl-N'-methyl-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 43180194 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N,N-diethyl-N'-methyl-1-phenylethane-1,2-diamine |
| SMILES | CCN(CC)C(CNC)c1ccccc1 |
| InChI | InChI=1S/C13H22N2/c1-4-15(5-2)13(11-14-3)12-9-7-6-8-10-12/h6-10,13-14H,4-5,11H2,1-3H3 |
| InChIKey | BLDHUBGINMQQCW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |