C16H24N2 — CID 113482426
N'-but-3-yn-2-yl-N,N-diethyl-1-phenylethane-1,2-diamine (PubChem CID 113482426) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N'-but-3-yn-2-yl-N,N-diethyl-1-phenylethane-1,2-diamine.
| Compound Name | N'-but-3-yn-2-yl-N,N-diethyl-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 113482426 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N'-but-3-yn-2-yl-N,N-diethyl-1-phenylethane-1,2-diamine |
| SMILES | C#CC(C)NCC(c1ccccc1)N(CC)CC |
| InChI | InChI=1S/C16H24N2/c1-5-14(4)17-13-16(18(6-2)7-3)15-11-9-8-10-12-15/h1,8-12,14,16-17H,6-7,13H2,2-4H3 |
| InChIKey | ICRRBHAUNMVKQM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|