C16H26N2O3 — CID 103235339
2-[[2-(diethylamino)-2-phenylethyl]amino]-3-methoxypropanoic acid (PubChem CID 103235339) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-[[2-(diethylamino)-2-phenylethyl]amino]-3-methoxypropanoic acid.
| Compound Name | 2-[[2-(diethylamino)-2-phenylethyl]amino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 103235339 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-[[2-(diethylamino)-2-phenylethyl]amino]-3-methoxypropanoic acid |
| SMILES | CCN(CC)C(CNC(COC)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H26N2O3/c1-4-18(5-2)15(13-9-7-6-8-10-13)11-17-14(12-21-3)16(19)20/h6-10,14-15,17H,4-5,11-12H2,1-3H3,(H,19,20) |
| InChIKey | CFNVSOKLDXBTGO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |