C10H15N — CID 2724276
(1S)-N,N-dimethyl-1-phenylethanamine (PubChem CID 2724276) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (1S)-N,N-dimethyl-1-phenylethanamine.
| Compound Name | (1S)-N,N-dimethyl-1-phenylethanamine |
|---|---|
| PubChem CID | 2724276 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (1S)-N,N-dimethyl-1-phenylethanamine |
| SMILES | C[C@@H](c1ccccc1)N(C)C |
| InChI | InChI=1S/C10H15N/c1-9(11(2)3)10-7-5-4-6-8-10/h4-9H,1-3H3/t9-/m0/s1 |
| InChIKey | BVURNMLGDQYNAF-VIFPVBQESA-N |
| XLogP | 2.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |