C11H14Cl2 — CID 70049955
1,5-dichloropentan-2-ylbenzene (PubChem CID 70049955) has the molecular formula C11H14Cl2 and a molecular weight of 217.14 g/mol. Its IUPAC name is 1,5-dichloropentan-2-ylbenzene.
| Compound Name | 1,5-dichloropentan-2-ylbenzene |
|---|---|
| PubChem CID | 70049955 |
| Molecular Formula | C11H14Cl2 |
| Molecular Weight | 217.14 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 1,5-dichloropentan-2-ylbenzene |
| SMILES | ClCCCC(CCl)c1ccccc1 |
| InChI | InChI=1S/C11H14Cl2/c12-8-4-7-11(9-13)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2 |
| InChIKey | BHTAXPXLLRNDQM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.14 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|