C21H29N — CID 54447002
(2S)-N-(3,3-diphenylpropyl)-N,3-dimethylbutan-2-amine (PubChem CID 54447002) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is (2S)-N-(3,3-diphenylpropyl)-N,3-dimethylbutan-2-amine.
| Compound Name | (2S)-N-(3,3-diphenylpropyl)-N,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 54447002 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | (2S)-N-(3,3-diphenylpropyl)-N,3-dimethylbutan-2-amine |
| SMILES | CC(C)[C@H](C)N(C)CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29N/c1-17(2)18(3)22(4)16-15-21(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,17-18,21H,15-16H2,1-4H3/t18-/m0/s1 |
| InChIKey | ZRHCPWKAWKDTTM-SFHVURJKSA-N |
| XLogP | 5.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |