C15H25ClNO3P — CID 12965021
(1R,2S)-1-chloro-N-(diethoxyphosphorylmethyl)-N-methyl-1-phenylpropan-2-amine (PubChem CID 12965021) has the molecular formula C15H25ClNO3P and a molecular weight of 333.80 g/mol. Its IUPAC name is (1R,2S)-1-chloro-N-(diethoxyphosphorylmethyl)-N-methyl-1-phenylpropan-2-amine.
| Compound Name | (1R,2S)-1-chloro-N-(diethoxyphosphorylmethyl)-N-methyl-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 12965021 |
| Molecular Formula | C15H25ClNO3P |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (1R,2S)-1-chloro-N-(diethoxyphosphorylmethyl)-N-methyl-1-phenylpropan-2-amine |
| SMILES | CCOP(=O)(CN(C)[C@@H](C)[C@H](Cl)c1ccccc1)OCC |
| InChI | InChI=1S/C15H25ClNO3P/c1-5-19-21(18,20-6-2)12-17(4)13(3)15(16)14-10-8-7-9-11-14/h7-11,13,15H,5-6,12H2,1-4H3/t13-,15-/m0/s1 |
| InChIKey | BFUSFVUMYYIRNB-ZFWWWQNUSA-N |
| XLogP | 4.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|