C14H24NO4P — CID 66624386
2-[diethoxyphosphoryl(methyl)amino]-1-phenylpropan-1-ol (PubChem CID 66624386) has the molecular formula C14H24NO4P and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-[diethoxyphosphoryl(methyl)amino]-1-phenylpropan-1-ol.
| Compound Name | 2-[diethoxyphosphoryl(methyl)amino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 66624386 |
| Molecular Formula | C14H24NO4P |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-[diethoxyphosphoryl(methyl)amino]-1-phenylpropan-1-ol |
| SMILES | CCOP(=O)(OCC)N(C)C(C)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H24NO4P/c1-5-18-20(17,19-6-2)15(4)12(3)14(16)13-10-8-7-9-11-13/h7-12,14,16H,5-6H2,1-4H3 |
| InChIKey | SRUXRJGQXKVHCB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|