C22H24NO2P — CID 124555381
(1S,2R)-2-[diphenylphosphoryl(methyl)amino]-1-phenylpropan-1-ol (PubChem CID 124555381) has the molecular formula C22H24NO2P and a molecular weight of 365.41 g/mol. Its IUPAC name is (1S,2R)-2-[diphenylphosphoryl(methyl)amino]-1-phenylpropan-1-ol.
| Compound Name | (1S,2R)-2-[diphenylphosphoryl(methyl)amino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 124555381 |
| Molecular Formula | C22H24NO2P |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (1S,2R)-2-[diphenylphosphoryl(methyl)amino]-1-phenylpropan-1-ol |
| SMILES | C[C@H]([C@@H](O)c1ccccc1)N(C)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24NO2P/c1-18(22(24)19-12-6-3-7-13-19)23(2)26(25,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-18,22,24H,1-2H3/t18-,22-/m1/s1 |
| InChIKey | ICBOYFKPRKHWSC-XMSQKQJNSA-N |
| XLogP | 3.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|