C27H28N2O2 — CID 10251124
(Z,4S,5S)-5-hydroxy-2-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]-4,5-diphenylpent-2-enenitrile (PubChem CID 10251124) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is (Z,4S,5S)-5-hydroxy-2-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]-4,5-diphenylpent-2-enenitrile.
| Compound Name | (Z,4S,5S)-5-hydroxy-2-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]-4,5-diphenylpent-2-enenitrile |
|---|---|
| PubChem CID | 10251124 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (Z,4S,5S)-5-hydroxy-2-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]-4,5-diphenylpent-2-enenitrile |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N(C)/C(C#N)=C\[C@@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O2/c1-20(26(30)22-14-8-4-9-15-22)29(2)24(19-28)18-25(21-12-6-3-7-13-21)27(31)23-16-10-5-11-17-23/h3-18,20,25-27,30-31H,1-2H3/b24-18-/t20-,25-,26-,27+/m0/s1 |
| InChIKey | FIRHRCXOGCNIFN-OXXNTTPSSA-N |
| XLogP | 4.97 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|