C23H25NO — CID 11484349
(1S,2S)-2-(dibenzylamino)-1-phenylpropan-1-ol (PubChem CID 11484349) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is (1S,2S)-2-(dibenzylamino)-1-phenylpropan-1-ol.
| Compound Name | (1S,2S)-2-(dibenzylamino)-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 11484349 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (1S,2S)-2-(dibenzylamino)-1-phenylpropan-1-ol |
| SMILES | C[C@@H]([C@@H](O)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H25NO/c1-19(23(25)22-15-9-4-10-16-22)24(17-20-11-5-2-6-12-20)18-21-13-7-3-8-14-21/h2-16,19,23,25H,17-18H2,1H3/t19-,23+/m0/s1 |
| InChIKey | BOZCOAZLVQXGKP-WMZHIEFXSA-N |
| XLogP | 4.81 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |