C17H30ClNO — CID 169438778
(1R,2S)-2-(dibutylamino)-1-phenylpropan-1-ol;hydrochloride (PubChem CID 169438778) has the molecular formula C17H30ClNO and a molecular weight of 299.89 g/mol. Its IUPAC name is (1R,2S)-2-(dibutylamino)-1-phenylpropan-1-ol;hydrochloride.
| Compound Name | (1R,2S)-2-(dibutylamino)-1-phenylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 169438778 |
| Molecular Formula | C17H30ClNO |
| Molecular Weight | 299.89 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (1R,2S)-2-(dibutylamino)-1-phenylpropan-1-ol;hydrochloride |
| SMILES | CCCCN(CCCC)[C@@H](C)[C@H](O)c1ccccc1.Cl |
| InChI | InChI=1S/C17H29NO.ClH/c1-4-6-13-18(14-7-5-2)15(3)17(19)16-11-9-8-10-12-16;/h8-12,15,17,19H,4-7,13-14H2,1-3H3;1H/t15-,17-;/m0./s1 |
| InChIKey | RGWRLUHFUIHNCG-NBLXOJGSSA-N |
| XLogP | 4.43 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.89 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |