C25H44ClNO — CID 98129728
(1R,2R)-1-(4-chlorophenyl)-2-(dioctylamino)propan-1-ol (PubChem CID 98129728) has the molecular formula C25H44ClNO and a molecular weight of 410.09 g/mol. Its IUPAC name is (1R,2R)-1-(4-chlorophenyl)-2-(dioctylamino)propan-1-ol.
| Compound Name | (1R,2R)-1-(4-chlorophenyl)-2-(dioctylamino)propan-1-ol |
|---|---|
| PubChem CID | 98129728 |
| Molecular Formula | C25H44ClNO |
| Molecular Weight | 410.09 g/mol |
| Exact Mass | 409.31 |
| IUPAC Name | (1R,2R)-1-(4-chlorophenyl)-2-(dioctylamino)propan-1-ol |
| SMILES | CCCCCCCCN(CCCCCCCC)[C@H](C)[C@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H44ClNO/c1-4-6-8-10-12-14-20-27(21-15-13-11-9-7-5-2)22(3)25(28)23-16-18-24(26)19-17-23/h16-19,22,25,28H,4-15,20-21H2,1-3H3/t22-,25+/m1/s1 |
| InChIKey | LOECSSCDXGDTPJ-RDGATRHJSA-N |
| XLogP | 7.78 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.09 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|