C33H48BrNO — CID 98563435
(1S,2R)-1-(9-bromophenanthren-3-yl)-2-(dioctylamino)propan-1-ol (PubChem CID 98563435) has the molecular formula C33H48BrNO and a molecular weight of 554.66 g/mol. Its IUPAC name is (1S,2R)-1-(9-bromophenanthren-3-yl)-2-(dioctylamino)propan-1-ol.
| Compound Name | (1S,2R)-1-(9-bromophenanthren-3-yl)-2-(dioctylamino)propan-1-ol |
|---|---|
| PubChem CID | 98563435 |
| Molecular Formula | C33H48BrNO |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | (1S,2R)-1-(9-bromophenanthren-3-yl)-2-(dioctylamino)propan-1-ol |
| SMILES | CCCCCCCCN(CCCCCCCC)[C@H](C)[C@@H](O)c1ccc2cc(Br)c3ccccc3c2c1 |
| InChI | InChI=1S/C33H48BrNO/c1-4-6-8-10-12-16-22-35(23-17-13-11-9-7-5-2)26(3)33(36)28-21-20-27-25-32(34)30-19-15-14-18-29(30)31(27)24-28/h14-15,18-21,24-26,33,36H,4-13,16-17,22-23H2,1-3H3/t26-,33-/m1/s1 |
| InChIKey | NKCKUGWRAMLUEQ-UTONBFNKSA-N |
| XLogP | 10.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|