C28H37Br2NO — CID 90668926
1-(3,6-dibromophenanthren-9-yl)-2-(dihexylamino)ethanol (PubChem CID 90668926) has the molecular formula C28H37Br2NO and a molecular weight of 563.42 g/mol. Its IUPAC name is 1-(3,6-dibromophenanthren-9-yl)-2-(dihexylamino)ethanol.
| Compound Name | 1-(3,6-dibromophenanthren-9-yl)-2-(dihexylamino)ethanol |
|---|---|
| PubChem CID | 90668926 |
| Molecular Formula | C28H37Br2NO |
| Molecular Weight | 563.42 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 1-(3,6-dibromophenanthren-9-yl)-2-(dihexylamino)ethanol |
| SMILES | CCCCCCN(CCCCCC)CC(O)c1cc2ccc(Br)cc2c2cc(Br)ccc12 |
| InChI | InChI=1S/C28H37Br2NO/c1-3-5-7-9-15-31(16-10-8-6-4-2)20-28(32)27-17-21-11-12-22(29)18-25(21)26-19-23(30)13-14-24(26)27/h11-14,17-19,28,32H,3-10,15-16,20H2,1-2H3 |
| InChIKey | WZFASNWQAVLOFT-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.42 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|