C23H34Cl2N2O — CID 90669659
1-(4,7-dichloroquinolin-3-yl)-2-(dihexylamino)ethanol (PubChem CID 90669659) has the molecular formula C23H34Cl2N2O and a molecular weight of 425.44 g/mol. Its IUPAC name is 1-(4,7-dichloroquinolin-3-yl)-2-(dihexylamino)ethanol.
| Compound Name | 1-(4,7-dichloroquinolin-3-yl)-2-(dihexylamino)ethanol |
|---|---|
| PubChem CID | 90669659 |
| Molecular Formula | C23H34Cl2N2O |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 1-(4,7-dichloroquinolin-3-yl)-2-(dihexylamino)ethanol |
| SMILES | CCCCCCN(CCCCCC)CC(O)c1cnc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C23H34Cl2N2O/c1-3-5-7-9-13-27(14-10-8-6-4-2)17-22(28)20-16-26-21-15-18(24)11-12-19(21)23(20)25/h11-12,15-16,22,28H,3-10,13-14,17H2,1-2H3 |
| InChIKey | YRUZOBDSEXVOIS-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|