C34H49ClN2O2 — CID 98128320
(1R)-1-[7-chloro-2-(4-methoxyphenyl)quinolin-4-yl]-2-(dioctylamino)ethanol (PubChem CID 98128320) has the molecular formula C34H49ClN2O2 and a molecular weight of 553.23 g/mol. Its IUPAC name is (1R)-1-[7-chloro-2-(4-methoxyphenyl)quinolin-4-yl]-2-(dioctylamino)ethanol.
| Compound Name | (1R)-1-[7-chloro-2-(4-methoxyphenyl)quinolin-4-yl]-2-(dioctylamino)ethanol |
|---|---|
| PubChem CID | 98128320 |
| Molecular Formula | C34H49ClN2O2 |
| Molecular Weight | 553.23 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | (1R)-1-[7-chloro-2-(4-methoxyphenyl)quinolin-4-yl]-2-(dioctylamino)ethanol |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H](O)c1cc(-c2ccc(OC)cc2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C34H49ClN2O2/c1-4-6-8-10-12-14-22-37(23-15-13-11-9-7-5-2)26-34(38)31-25-32(27-16-19-29(39-3)20-17-27)36-33-24-28(35)18-21-30(31)33/h16-21,24-25,34,38H,4-15,22-23,26H2,1-3H3/t34-/m0/s1 |
| InChIKey | IMURMHKTFOHKIE-UMSFTDKQSA-N |
| XLogP | 9.62 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.23 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|