C25H44ClNO2 — CID 98529562
(1R)-1-(5-chloro-2-methoxyphenyl)-2-(dioctylamino)ethanol (PubChem CID 98529562) has the molecular formula C25H44ClNO2 and a molecular weight of 426.09 g/mol. Its IUPAC name is (1R)-1-(5-chloro-2-methoxyphenyl)-2-(dioctylamino)ethanol.
| Compound Name | (1R)-1-(5-chloro-2-methoxyphenyl)-2-(dioctylamino)ethanol |
|---|---|
| PubChem CID | 98529562 |
| Molecular Formula | C25H44ClNO2 |
| Molecular Weight | 426.09 g/mol |
| Exact Mass | 425.31 |
| IUPAC Name | (1R)-1-(5-chloro-2-methoxyphenyl)-2-(dioctylamino)ethanol |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H](O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C25H44ClNO2/c1-4-6-8-10-12-14-18-27(19-15-13-11-9-7-5-2)21-24(28)23-20-22(26)16-17-25(23)29-3/h16-17,20,24,28H,4-15,18-19,21H2,1-3H3/t24-/m0/s1 |
| InChIKey | SJKFTRYJCASSJE-DEOSSOPVSA-N |
| XLogP | 7.41 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.09 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|