C31H43ClN2O3 — CID 90669178
1-[6-chloro-7-methoxy-2-(4-methoxyphenyl)quinolin-4-yl]-2-(dihexylamino)ethanol (PubChem CID 90669178) has the molecular formula C31H43ClN2O3 and a molecular weight of 527.15 g/mol. Its IUPAC name is 1-[6-chloro-7-methoxy-2-(4-methoxyphenyl)quinolin-4-yl]-2-(dihexylamino)ethanol.
| Compound Name | 1-[6-chloro-7-methoxy-2-(4-methoxyphenyl)quinolin-4-yl]-2-(dihexylamino)ethanol |
|---|---|
| PubChem CID | 90669178 |
| Molecular Formula | C31H43ClN2O3 |
| Molecular Weight | 527.15 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | 1-[6-chloro-7-methoxy-2-(4-methoxyphenyl)quinolin-4-yl]-2-(dihexylamino)ethanol |
| SMILES | CCCCCCN(CCCCCC)CC(O)c1cc(-c2ccc(OC)cc2)nc2cc(OC)c(Cl)cc12 |
| InChI | InChI=1S/C31H43ClN2O3/c1-5-7-9-11-17-34(18-12-10-8-6-2)22-30(35)26-20-28(23-13-15-24(36-3)16-14-23)33-29-21-31(37-4)27(32)19-25(26)29/h13-16,19-21,30,35H,5-12,17-18,22H2,1-4H3 |
| InChIKey | PMHOUYZVFQSMCS-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.15 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|