C28H40Cl2N2O2 — CID 21146200
4-(dibutylamino)-1-(6-methoxy-2-phenylquinolin-4-yl)butan-1-ol;dihydrochloride (PubChem CID 21146200) has the molecular formula C28H40Cl2N2O2 and a molecular weight of 507.55 g/mol. Its IUPAC name is 4-(dibutylamino)-1-(6-methoxy-2-phenylquinolin-4-yl)butan-1-ol;dihydrochloride.
| Compound Name | 4-(dibutylamino)-1-(6-methoxy-2-phenylquinolin-4-yl)butan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 21146200 |
| Molecular Formula | C28H40Cl2N2O2 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 4-(dibutylamino)-1-(6-methoxy-2-phenylquinolin-4-yl)butan-1-ol;dihydrochloride |
| SMILES | CCCCN(CCCC)CCCC(O)c1cc(-c2ccccc2)nc2ccc(OC)cc12.Cl.Cl |
| InChI | InChI=1S/C28H38N2O2.2ClH/c1-4-6-17-30(18-7-5-2)19-11-14-28(31)25-21-27(22-12-9-8-10-13-22)29-26-16-15-23(32-3)20-24(25)26;;/h8-10,12-13,15-16,20-21,28,31H,4-7,11,14,17-19H2,1-3H3;2*1H |
| InChIKey | SUGXIMPICYVSRX-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |