C25H36N3O5P — CID 22210394
1-N,1-N-diethyl-4-N-(6-methoxy-2-phenylquinolin-4-yl)pentane-1,4-diamine;phosphoric acid (PubChem CID 22210394) has the molecular formula C25H36N3O5P and a molecular weight of 489.55 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-(6-methoxy-2-phenylquinolin-4-yl)pentane-1,4-diamine;phosphoric acid.
| Compound Name | 1-N,1-N-diethyl-4-N-(6-methoxy-2-phenylquinolin-4-yl)pentane-1,4-diamine;phosphoric acid |
|---|---|
| PubChem CID | 22210394 |
| Molecular Formula | C25H36N3O5P |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-(6-methoxy-2-phenylquinolin-4-yl)pentane-1,4-diamine;phosphoric acid |
| SMILES | CCN(CC)CCCC(C)Nc1cc(-c2ccccc2)nc2ccc(OC)cc12.O=P(O)(O)O |
| InChI | InChI=1S/C25H33N3O.H3O4P/c1-5-28(6-2)16-10-11-19(3)26-25-18-24(20-12-8-7-9-13-20)27-23-15-14-21(29-4)17-22(23)25;1-5(2,3)4/h7-9,12-15,17-19H,5-6,10-11,16H2,1-4H3,(H,26,27);(H3,1,2,3,4) |
| InChIKey | JDQIDHUJPIHVHD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|