C23H36N4O8P2 — CID 131880768
1-N,1-N-diethyl-4-N-(2-phenylquinazolin-4-yl)pentane-1,4-diamine;phosphoric acid (PubChem CID 131880768) has the molecular formula C23H36N4O8P2 and a molecular weight of 558.51 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-(2-phenylquinazolin-4-yl)pentane-1,4-diamine;phosphoric acid.
| Compound Name | 1-N,1-N-diethyl-4-N-(2-phenylquinazolin-4-yl)pentane-1,4-diamine;phosphoric acid |
|---|---|
| PubChem CID | 131880768 |
| Molecular Formula | C23H36N4O8P2 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-(2-phenylquinazolin-4-yl)pentane-1,4-diamine;phosphoric acid |
| SMILES | CCN(CC)CCCC(C)Nc1nc(-c2ccccc2)nc2ccccc12.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C23H30N4.2H3O4P/c1-4-27(5-2)17-11-12-18(3)24-23-20-15-9-10-16-21(20)25-22(26-23)19-13-7-6-8-14-19;2*1-5(2,3)4/h6-10,13-16,18H,4-5,11-12,17H2,1-3H3,(H,24,25,26);2*(H3,1,2,3,4) |
| InChIKey | YEZJVDLVFHHWIY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 196.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|