C23H30N6O2 — CID 12703358
2-N-[5-(diethylamino)pentan-2-yl]-4-N-(4-nitrophenyl)quinazoline-2,4-diamine (PubChem CID 12703358) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-N-[5-(diethylamino)pentan-2-yl]-4-N-(4-nitrophenyl)quinazoline-2,4-diamine.
| Compound Name | 2-N-[5-(diethylamino)pentan-2-yl]-4-N-(4-nitrophenyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 12703358 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-N-[5-(diethylamino)pentan-2-yl]-4-N-(4-nitrophenyl)quinazoline-2,4-diamine |
| SMILES | CCN(CC)CCCC(C)Nc1nc(Nc2ccc([N+](=O)[O-])cc2)c2ccccc2n1 |
| InChI | InChI=1S/C23H30N6O2/c1-4-28(5-2)16-8-9-17(3)24-23-26-21-11-7-6-10-20(21)22(27-23)25-18-12-14-19(15-13-18)29(30)31/h6-7,10-15,17H,4-5,8-9,16H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | OSMONFDUBXBRCP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|