C22H29ClN4 — CID 15946061
4-N-(2-chloro-4-methylbenzo[c][2,7]naphthyridin-5-yl)-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 15946061) has the molecular formula C22H29ClN4 and a molecular weight of 384.96 g/mol. Its IUPAC name is 4-N-(2-chloro-4-methylbenzo[c][2,7]naphthyridin-5-yl)-1-N,1-N-diethylpentane-1,4-diamine.
| Compound Name | 4-N-(2-chloro-4-methylbenzo[c][2,7]naphthyridin-5-yl)-1-N,1-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 15946061 |
| Molecular Formula | C22H29ClN4 |
| Molecular Weight | 384.96 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 4-N-(2-chloro-4-methylbenzo[c][2,7]naphthyridin-5-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)Nc1nc2ccccc2c2cc(Cl)nc(C)c12 |
| InChI | InChI=1S/C22H29ClN4/c1-5-27(6-2)13-9-10-15(3)24-22-21-16(4)25-20(23)14-18(21)17-11-7-8-12-19(17)26-22/h7-8,11-12,14-15H,5-6,9-10,13H2,1-4H3,(H,24,26) |
| InChIKey | KSHPLPIRFNGEJF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.96 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|