C23H31BrClN3 — CID 21144133
4-N-(2-bromo-4-methylacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine;hydrochloride (PubChem CID 21144133) has the molecular formula C23H31BrClN3 and a molecular weight of 464.88 g/mol. Its IUPAC name is 4-N-(2-bromo-4-methylacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine;hydrochloride.
| Compound Name | 4-N-(2-bromo-4-methylacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 21144133 |
| Molecular Formula | C23H31BrClN3 |
| Molecular Weight | 464.88 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 4-N-(2-bromo-4-methylacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine;hydrochloride |
| SMILES | CCN(CC)CCCC(C)Nc1c2ccccc2nc2c(C)cc(Br)cc12.Cl |
| InChI | InChI=1S/C23H30BrN3.ClH/c1-5-27(6-2)13-9-10-17(4)25-23-19-11-7-8-12-21(19)26-22-16(3)14-18(24)15-20(22)23;/h7-8,11-12,14-15,17H,5-6,9-10,13H2,1-4H3,(H,25,26);1H |
| InChIKey | NBLJTBRKDHUSRD-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.88 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|