C17H25BrN4 — CID 129385047
(4S)-4-N-(6-bromoquinazolin-2-yl)-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 129385047) has the molecular formula C17H25BrN4 and a molecular weight of 365.32 g/mol. Its IUPAC name is (4S)-4-N-(6-bromoquinazolin-2-yl)-1-N,1-N-diethylpentane-1,4-diamine.
| Compound Name | (4S)-4-N-(6-bromoquinazolin-2-yl)-1-N,1-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 129385047 |
| Molecular Formula | C17H25BrN4 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (4S)-4-N-(6-bromoquinazolin-2-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)CCC[C@H](C)Nc1ncc2cc(Br)ccc2n1 |
| InChI | InChI=1S/C17H25BrN4/c1-4-22(5-2)10-6-7-13(3)20-17-19-12-14-11-15(18)8-9-16(14)21-17/h8-9,11-13H,4-7,10H2,1-3H3,(H,19,20,21)/t13-/m0/s1 |
| InChIKey | LNTFPKIPUHGRQD-ZDUSSCGKSA-N |
| XLogP | 4.31 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |