C14H25BrN4 — CID 79532522
3-bromo-2-N-[5-(diethylamino)pentan-2-yl]pyridine-2,5-diamine (PubChem CID 79532522) has the molecular formula C14H25BrN4 and a molecular weight of 329.29 g/mol. Its IUPAC name is 3-bromo-2-N-[5-(diethylamino)pentan-2-yl]pyridine-2,5-diamine.
| Compound Name | 3-bromo-2-N-[5-(diethylamino)pentan-2-yl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 79532522 |
| Molecular Formula | C14H25BrN4 |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 3-bromo-2-N-[5-(diethylamino)pentan-2-yl]pyridine-2,5-diamine |
| SMILES | CCN(CC)CCCC(C)Nc1ncc(N)cc1Br |
| InChI | InChI=1S/C14H25BrN4/c1-4-19(5-2)8-6-7-11(3)18-14-13(15)9-12(16)10-17-14/h9-11H,4-8,16H2,1-3H3,(H,17,18) |
| InChIKey | ILAAQGWNVZHBKB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |