About 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine
3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine (PubChem CID 104827426) has the molecular formula C11H18BrN3
and a molecular weight of 272.19 g/mol. Its IUPAC name is 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine |
| PubChem CID | 104827426 |
| Molecular Formula | C11H18BrN3 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine |
| SMILES | CC(Nc1ncc(N)cc1Br)C(C)(C)C |
| InChI | InChI=1S/C11H18BrN3/c1-7(11(2,3)4)15-10-9(12)5-8(13)6-14-10/h5-7H,13H2,1-4H3,(H,14,15) |
| InChIKey | HITAMUFUXNYOIH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine?
The IUPAC name of 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine (CID 104827426) is 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine.
What is the SMILES notation for 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine?
The canonical SMILES for 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine is CC(Nc1ncc(N)cc1Br)C(C)(C)C.
What is the InChIKey of 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine?
The InChIKey is HITAMUFUXNYOIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18BrN3/c1-7(11(2,3)4)15-10-9(12)5-8(13)6-14-10/h5-7H,13H2,1-4H3,(H,14,15).
What are the key properties of 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine?
3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine has a molecular weight of 272.19 g/mol, XLogP of 3.27, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine is sourced from PubChem (CID 104827426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).