C11H18BrN3 — CID 104827426
3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine (PubChem CID 104827426) has the molecular formula C11H18BrN3 and a molecular weight of 272.19 g/mol. Its IUPAC name is 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine.
| Compound Name | 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 104827426 |
| Molecular Formula | C11H18BrN3 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 3-bromo-2-N-(3,3-dimethylbutan-2-yl)pyridine-2,5-diamine |
| SMILES | CC(Nc1ncc(N)cc1Br)C(C)(C)C |
| InChI | InChI=1S/C11H18BrN3/c1-7(11(2,3)4)15-10-9(12)5-8(13)6-14-10/h5-7H,13H2,1-4H3,(H,14,15) |
| InChIKey | HITAMUFUXNYOIH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |