C11H18BrN3O — CID 79535461
3-bromo-2-N-(1-methoxypentan-2-yl)pyridine-2,5-diamine (PubChem CID 79535461) has the molecular formula C11H18BrN3O and a molecular weight of 288.19 g/mol. Its IUPAC name is 3-bromo-2-N-(1-methoxypentan-2-yl)pyridine-2,5-diamine.
| Compound Name | 3-bromo-2-N-(1-methoxypentan-2-yl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 79535461 |
| Molecular Formula | C11H18BrN3O |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-bromo-2-N-(1-methoxypentan-2-yl)pyridine-2,5-diamine |
| SMILES | CCCC(COC)Nc1ncc(N)cc1Br |
| InChI | InChI=1S/C11H18BrN3O/c1-3-4-9(7-16-2)15-11-10(12)5-8(13)6-14-11/h5-6,9H,3-4,7,13H2,1-2H3,(H,14,15) |
| InChIKey | PBPOAVNKBQUJFC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |