C11H16BrClN2O — CID 103582537
5-bromo-3-chloro-N-(1-methoxypentan-2-yl)pyridin-2-amine (PubChem CID 103582537) has the molecular formula C11H16BrClN2O and a molecular weight of 307.62 g/mol. Its IUPAC name is 5-bromo-3-chloro-N-(1-methoxypentan-2-yl)pyridin-2-amine.
| Compound Name | 5-bromo-3-chloro-N-(1-methoxypentan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 103582537 |
| Molecular Formula | C11H16BrClN2O |
| Molecular Weight | 307.62 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 5-bromo-3-chloro-N-(1-methoxypentan-2-yl)pyridin-2-amine |
| SMILES | CCCC(COC)Nc1ncc(Br)cc1Cl |
| InChI | InChI=1S/C11H16BrClN2O/c1-3-4-9(7-16-2)15-11-10(13)5-8(12)6-14-11/h5-6,9H,3-4,7H2,1-2H3,(H,14,15) |
| InChIKey | HDIATCGLIYGDJZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |