C12H19BrN2 — CID 79718700
5-bromo-N-hexan-3-yl-3-methylpyridin-2-amine (PubChem CID 79718700) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 5-bromo-N-hexan-3-yl-3-methylpyridin-2-amine.
| Compound Name | 5-bromo-N-hexan-3-yl-3-methylpyridin-2-amine |
|---|---|
| PubChem CID | 79718700 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 5-bromo-N-hexan-3-yl-3-methylpyridin-2-amine |
| SMILES | CCCC(CC)Nc1ncc(Br)cc1C |
| InChI | InChI=1S/C12H19BrN2/c1-4-6-11(5-2)15-12-9(3)7-10(13)8-14-12/h7-8,11H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | CQCGEMRPBOSORU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |