C11H12Br2N2 — CID 106231623
3,5-dibromo-N-hex-1-yn-3-ylpyridin-2-amine (PubChem CID 106231623) has the molecular formula C11H12Br2N2 and a molecular weight of 332.04 g/mol. Its IUPAC name is 3,5-dibromo-N-hex-1-yn-3-ylpyridin-2-amine.
| Compound Name | 3,5-dibromo-N-hex-1-yn-3-ylpyridin-2-amine |
|---|---|
| PubChem CID | 106231623 |
| Molecular Formula | C11H12Br2N2 |
| Molecular Weight | 332.04 g/mol |
| Exact Mass | 329.94 |
| IUPAC Name | 3,5-dibromo-N-hex-1-yn-3-ylpyridin-2-amine |
| SMILES | C#CC(CCC)Nc1ncc(Br)cc1Br |
| InChI | InChI=1S/C11H12Br2N2/c1-3-5-9(4-2)15-11-10(13)6-8(12)7-14-11/h2,6-7,9H,3,5H2,1H3,(H,14,15) |
| InChIKey | AGIBZZAHBQMLQR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.04 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|