C11H14BrN3 — CID 106233126
5-bromo-2-N-hex-1-yn-3-ylpyridine-2,3-diamine (PubChem CID 106233126) has the molecular formula C11H14BrN3 and a molecular weight of 268.16 g/mol. Its IUPAC name is 5-bromo-2-N-hex-1-yn-3-ylpyridine-2,3-diamine.
| Compound Name | 5-bromo-2-N-hex-1-yn-3-ylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 106233126 |
| Molecular Formula | C11H14BrN3 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 5-bromo-2-N-hex-1-yn-3-ylpyridine-2,3-diamine |
| SMILES | C#CC(CCC)Nc1ncc(Br)cc1N |
| InChI | InChI=1S/C11H14BrN3/c1-3-5-9(4-2)15-11-10(13)6-8(12)7-14-11/h2,6-7,9H,3,5,13H2,1H3,(H,14,15) |
| InChIKey | ONWNCHOTAOFCPY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|