C11H14ClN3 — CID 106232841
2-chloro-N-hex-1-yn-3-yl-5-methylpyrimidin-4-amine (PubChem CID 106232841) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is 2-chloro-N-hex-1-yn-3-yl-5-methylpyrimidin-4-amine.
| Compound Name | 2-chloro-N-hex-1-yn-3-yl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106232841 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-chloro-N-hex-1-yn-3-yl-5-methylpyrimidin-4-amine |
| SMILES | C#CC(CCC)Nc1nc(Cl)ncc1C |
| InChI | InChI=1S/C11H14ClN3/c1-4-6-9(5-2)14-10-8(3)7-13-11(12)15-10/h2,7,9H,4,6H2,1,3H3,(H,13,14,15) |
| InChIKey | PWVDTLFTDCRWDA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|