C11H13ClN2 — CID 106231577
5-chloro-N-hex-1-yn-3-ylpyridin-2-amine (PubChem CID 106231577) has the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. Its IUPAC name is 5-chloro-N-hex-1-yn-3-ylpyridin-2-amine.
| Compound Name | 5-chloro-N-hex-1-yn-3-ylpyridin-2-amine |
|---|---|
| PubChem CID | 106231577 |
| Molecular Formula | C11H13ClN2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 5-chloro-N-hex-1-yn-3-ylpyridin-2-amine |
| SMILES | C#CC(CCC)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C11H13ClN2/c1-3-5-10(4-2)14-11-7-6-9(12)8-13-11/h2,6-8,10H,3,5H2,1H3,(H,13,14) |
| InChIKey | UIRZAIBYIUVYNL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|