C14H19N3O — CID 114161515
6-(hex-1-yn-3-ylamino)-N,N-dimethylpyridine-3-carboxamide (PubChem CID 114161515) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 6-(hex-1-yn-3-ylamino)-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 6-(hex-1-yn-3-ylamino)-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 114161515 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 6-(hex-1-yn-3-ylamino)-N,N-dimethylpyridine-3-carboxamide |
| SMILES | C#CC(CCC)Nc1ccc(C(=O)N(C)C)cn1 |
| InChI | InChI=1S/C14H19N3O/c1-5-7-12(6-2)16-13-9-8-11(10-15-13)14(18)17(3)4/h2,8-10,12H,5,7H2,1,3-4H3,(H,15,16) |
| InChIKey | ZUMAYPSMFNOACV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|