About 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine
5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine (PubChem CID 6610512) has the molecular formula C11H14ClN5
and a molecular weight of 251.72 g/mol. Its IUPAC name is 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine |
| PubChem CID | 6610512 |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine |
| SMILES | CCCC(Nc1ccc(Cl)cn1)n1cncn1 |
| InChI | InChI=1S/C11H14ClN5/c1-2-3-11(17-8-13-7-15-17)16-10-5-4-9(12)6-14-10/h4-8,11H,2-3H2,1H3,(H,14,16) |
| InChIKey | JPMLTQRBIMQHMP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine?
The IUPAC name of 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine (CID 6610512) is 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine.
What is the SMILES notation for 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine?
The canonical SMILES for 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine is CCCC(Nc1ccc(Cl)cn1)n1cncn1.
What is the InChIKey of 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine?
The InChIKey is JPMLTQRBIMQHMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN5/c1-2-3-11(17-8-13-7-15-17)16-10-5-4-9(12)6-14-10/h4-8,11H,2-3H2,1H3,(H,14,16).
What are the key properties of 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine?
5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine has a molecular weight of 251.72 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine is sourced from PubChem (CID 6610512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).