C11H14ClN5 — CID 6610512
5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine (PubChem CID 6610512) has the molecular formula C11H14ClN5 and a molecular weight of 251.72 g/mol. Its IUPAC name is 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine.
| Compound Name | 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine |
|---|---|
| PubChem CID | 6610512 |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5-chloro-N-[1-(1,2,4-triazol-1-yl)butyl]pyridin-2-amine |
| SMILES | CCCC(Nc1ccc(Cl)cn1)n1cncn1 |
| InChI | InChI=1S/C11H14ClN5/c1-2-3-11(17-8-13-7-15-17)16-10-5-4-9(12)6-14-10/h4-8,11H,2-3H2,1H3,(H,14,16) |
| InChIKey | JPMLTQRBIMQHMP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |