C11H18ClN3 — CID 79075572
2-chloro-5-methyl-N-(3-methylpentan-2-yl)pyrimidin-4-amine (PubChem CID 79075572) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 2-chloro-5-methyl-N-(3-methylpentan-2-yl)pyrimidin-4-amine.
| Compound Name | 2-chloro-5-methyl-N-(3-methylpentan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 79075572 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-chloro-5-methyl-N-(3-methylpentan-2-yl)pyrimidin-4-amine |
| SMILES | CCC(C)C(C)Nc1nc(Cl)ncc1C |
| InChI | InChI=1S/C11H18ClN3/c1-5-7(2)9(4)14-10-8(3)6-13-11(12)15-10/h6-7,9H,5H2,1-4H3,(H,13,14,15) |
| InChIKey | IUXQEBJVTDDTIP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |