About 2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol
2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 107854394) has the molecular formula C9H14ClN3O3
and a molecular weight of 247.68 g/mol. Its IUPAC name is 2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol |
| PubChem CID | 107854394 |
| Molecular Formula | C9H14ClN3O3 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | Cc1cnc(Cl)nc1NC(CO)(CO)CO |
| InChI | InChI=1S/C9H14ClN3O3/c1-6-2-11-8(10)12-7(6)13-9(3-14,4-15)5-16/h2,14-16H,3-5H2,1H3,(H,11,12,13) |
| InChIKey | LDWFJQUGWMRQGQ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol?
The IUPAC name of 2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol (CID 107854394) is 2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol.
What is the SMILES notation for 2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol?
The canonical SMILES for 2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol is Cc1cnc(Cl)nc1NC(CO)(CO)CO.
What is the InChIKey of 2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol?
The InChIKey is LDWFJQUGWMRQGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClN3O3/c1-6-2-11-8(10)12-7(6)13-9(3-14,4-15)5-16/h2,14-16H,3-5H2,1H3,(H,11,12,13).
What are the key properties of 2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol?
2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol has a molecular weight of 247.68 g/mol, XLogP of -0.43, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-5-methylpyrimidin-4-yl)amino]-2-(hydroxymethyl)propane-1,3-diol is sourced from PubChem (CID 107854394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).