C10H14ClN3 — CID 106195918
2-chloro-5-methyl-N-[(E)-pent-3-enyl]pyrimidin-4-amine (PubChem CID 106195918) has the molecular formula C10H14ClN3 and a molecular weight of 211.70 g/mol. Its IUPAC name is 2-chloro-5-methyl-N-[(E)-pent-3-enyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-5-methyl-N-[(E)-pent-3-enyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106195918 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 2-chloro-5-methyl-N-[(E)-pent-3-enyl]pyrimidin-4-amine |
| SMILES | C/C=C/CCNc1nc(Cl)ncc1C |
| InChI | InChI=1S/C10H14ClN3/c1-3-4-5-6-12-9-8(2)7-13-10(11)14-9/h3-4,7H,5-6H2,1-2H3,(H,12,13,14)/b4-3+ |
| InChIKey | UHCAFPCKEJLUOQ-ONEGZZNKSA-N |
| XLogP | 2.82 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|