C8H10Cl2N4 — CID 106195869
4,6-dichloro-N-[(E)-pent-3-enyl]-1,3,5-triazin-2-amine (PubChem CID 106195869) has the molecular formula C8H10Cl2N4 and a molecular weight of 233.10 g/mol. Its IUPAC name is 4,6-dichloro-N-[(E)-pent-3-enyl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-[(E)-pent-3-enyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106195869 |
| Molecular Formula | C8H10Cl2N4 |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 4,6-dichloro-N-[(E)-pent-3-enyl]-1,3,5-triazin-2-amine |
| SMILES | C/C=C/CCNc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C8H10Cl2N4/c1-2-3-4-5-11-8-13-6(9)12-7(10)14-8/h2-3H,4-5H2,1H3,(H,11,12,13,14)/b3-2+ |
| InChIKey | RHALLRNBTMLCTA-NSCUHMNNSA-N |
| XLogP | 2.56 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|