C6H5Cl2N5 — CID 21443697
3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]propanenitrile (PubChem CID 21443697) has the molecular formula C6H5Cl2N5 and a molecular weight of 218.05 g/mol. Its IUPAC name is 3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]propanenitrile.
| Compound Name | 3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 21443697 |
| Molecular Formula | C6H5Cl2N5 |
| Molecular Weight | 218.05 g/mol |
| Exact Mass | 216.99 |
| IUPAC Name | 3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]propanenitrile |
| SMILES | N#CCCNc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C6H5Cl2N5/c7-4-11-5(8)13-6(12-4)10-3-1-2-9/h1,3H2,(H,10,11,12,13) |
| InChIKey | ZMEIYQZYNZPHQR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.05 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|