C7H9ClN6 — CID 118948902
3-[(2,5-diamino-6-chloropyrimidin-4-yl)amino]propanenitrile (PubChem CID 118948902) has the molecular formula C7H9ClN6 and a molecular weight of 212.64 g/mol. Its IUPAC name is 3-[(2,5-diamino-6-chloropyrimidin-4-yl)amino]propanenitrile.
| Compound Name | 3-[(2,5-diamino-6-chloropyrimidin-4-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 118948902 |
| Molecular Formula | C7H9ClN6 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 3-[(2,5-diamino-6-chloropyrimidin-4-yl)amino]propanenitrile |
| SMILES | N#CCCNc1nc(N)nc(Cl)c1N |
| InChI | InChI=1S/C7H9ClN6/c8-5-4(10)6(12-3-1-2-9)14-7(11)13-5/h1,3,10H2,(H3,11,12,13,14) |
| InChIKey | IAVNTDILWYEMKM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|