C9H15ClN4O — CID 82459192
6-chloro-2-ethyl-4-N-(2-methoxyethyl)pyrimidine-4,5-diamine (PubChem CID 82459192) has the molecular formula C9H15ClN4O and a molecular weight of 230.70 g/mol. Its IUPAC name is 6-chloro-2-ethyl-4-N-(2-methoxyethyl)pyrimidine-4,5-diamine.
| Compound Name | 6-chloro-2-ethyl-4-N-(2-methoxyethyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82459192 |
| Molecular Formula | C9H15ClN4O |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 6-chloro-2-ethyl-4-N-(2-methoxyethyl)pyrimidine-4,5-diamine |
| SMILES | CCc1nc(Cl)c(N)c(NCCOC)n1 |
| InChI | InChI=1S/C9H15ClN4O/c1-3-6-13-8(10)7(11)9(14-6)12-4-5-15-2/h3-5,11H2,1-2H3,(H,12,13,14) |
| InChIKey | YDIAMPQJAGEYKA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|