C15H19ClN4 — CID 82459378
6-chloro-4-N-(2-phenylethyl)-2-propylpyrimidine-4,5-diamine (PubChem CID 82459378) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is 6-chloro-4-N-(2-phenylethyl)-2-propylpyrimidine-4,5-diamine.
| Compound Name | 6-chloro-4-N-(2-phenylethyl)-2-propylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82459378 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 6-chloro-4-N-(2-phenylethyl)-2-propylpyrimidine-4,5-diamine |
| SMILES | CCCc1nc(Cl)c(N)c(NCCc2ccccc2)n1 |
| InChI | InChI=1S/C15H19ClN4/c1-2-6-12-19-14(16)13(17)15(20-12)18-10-9-11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10,17H2,1H3,(H,18,19,20) |
| InChIKey | FUAIBYJRFHZQAZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |