C16H20N2 — CID 83962401
1-N-ethyl-4-N-(2-phenylethyl)benzene-1,4-diamine (PubChem CID 83962401) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-N-ethyl-4-N-(2-phenylethyl)benzene-1,4-diamine.
| Compound Name | 1-N-ethyl-4-N-(2-phenylethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 83962401 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-N-ethyl-4-N-(2-phenylethyl)benzene-1,4-diamine |
| SMILES | CCNc1ccc(NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H20N2/c1-2-17-15-8-10-16(11-9-15)18-13-12-14-6-4-3-5-7-14/h3-11,17-18H,2,12-13H2,1H3 |
| InChIKey | GMBQFRZKVDXBQR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |